| Name |
1-{1-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl}piperazine
|
| Molecular Formula |
C15H20N4O
|
| Molecular Weight |
272.35
|
| Smiles |
Cc1ccc(-c2noc(C(C)N3CCNCC3)n2)cc1
|
Cc1ccc(-c2noc(C(C)N3CCNCC3)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.