| Name |
N'-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}benzenesulfonyl)-4,6-bis(trifluoromethyl)pyridine-2-carbohydrazide
|
| Molecular Formula |
C20H10ClF9N4O4S
|
| Molecular Weight |
608.8
|
| Smiles |
O=C(NNS(=O)(=O)c1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)n1
|
O=C(NNS(=O)(=O)c1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.