| Name |
N-(1-cyanocycloheptyl)-2-({2,8-dicyclopropyl-5,7-dioxo-5H,6H,7H,8H-pyrimido[4,5-d][1,3]diazin-4-yl}sulfanyl)acetamide
|
| Molecular Formula |
C22H26N6O3S
|
| Molecular Weight |
454.5
|
| Smiles |
N#CC1(NC(=O)CSc2nc(C3CC3)nc3c2c(=O)[nH]c(=O)n3C2CC2)CCCCCC1
|
N#CC1(NC(=O)CSc2nc(C3CC3)nc3c2c(=O)[nH]c(=O)n3C2CC2)CCCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.