| Name |
N-(5-benzyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-2-((4-chlorophenyl)thio)acetamide hydrochloride
|
| Molecular Formula |
C21H21Cl2N3OS2
|
| Molecular Weight |
466.4
|
| Smiles |
Cl.O=C(CSc1ccc(Cl)cc1)Nc1nc2c(s1)CN(Cc1ccccc1)CC2
|
Cl.O=C(CSc1ccc(Cl)cc1)Nc1nc2c(s1)CN(Cc1ccccc1)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.