| Name |
methyl 6-(2-methoxyphenyl)-8-methyl-4-oxo-2H,3H,4H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
|
| Molecular Formula |
C17H18N2O4S
|
| Molecular Weight |
346.4
|
| Smiles |
COC(=O)C1=C(C)N=C2SCCC(=O)N2C1c1ccccc1OC
|
COC(=O)C1=C(C)N=C2SCCC(=O)N2C1c1ccccc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.