| Name |
1-{[2-(2,6-Dichlorophenyl)-1,3-thiazol-4-yl]acetyl}piperidine-3-carboxylic acid
|
| Molecular Formula |
C17H16Cl2N2O3S
|
| Molecular Weight |
399.3
|
| Smiles |
O=C(O)C1CCCN(C(=O)Cc2csc(-c3c(Cl)cccc3Cl)n2)C1
|
O=C(O)C1CCCN(C(=O)Cc2csc(-c3c(Cl)cccc3Cl)n2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.