| Name |
N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide
|
| Molecular Formula |
C19H12F2N4O4
|
| Molecular Weight |
398.3
|
| Smiles |
O=C(Nc1nnc(-c2ccc(F)cc2F)o1)c1ccc(N2C(=O)CCC2=O)cc1
|
O=C(Nc1nnc(-c2ccc(F)cc2F)o1)c1ccc(N2C(=O)CCC2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.