| Name |
N-(2,6-dimethylphenyl)-2-{2-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrrol-1-yl}acetamide
|
| Molecular Formula |
C22H19FN4O2
|
| Molecular Weight |
390.4
|
| Smiles |
Cc1cccc(C)c1NC(=O)Cn1cccc1-c1nc(-c2ccc(F)cc2)no1
|
Cc1cccc(C)c1NC(=O)Cn1cccc1-c1nc(-c2ccc(F)cc2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.