| Name |
5-bromo-3-methyl-N-{4-[4-(prop-2-en-1-yloxy)phenyl]-1,2,5-oxadiazol-3-yl}-1-benzofuran-2-carboxamide
|
| Molecular Formula |
C21H16BrN3O4
|
| Molecular Weight |
454.3
|
| Smiles |
C=CCOc1ccc(-c2nonc2NC(=O)c2oc3ccc(Br)cc3c2C)cc1
|
C=CCOc1ccc(-c2nonc2NC(=O)c2oc3ccc(Br)cc3c2C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.