| Name |
6-(4-((3,5-Dimethylphenyl)sulfonyl)piperazin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazine
|
| Molecular Formula |
C17H20N6O2S
|
| Molecular Weight |
372.4
|
| Smiles |
Cc1cc(C)cc(S(=O)(=O)N2CCN(c3ccc4nncn4n3)CC2)c1
|
Cc1cc(C)cc(S(=O)(=O)N2CCN(c3ccc4nncn4n3)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.