| Name |
rel-3-[(3aR,4R,9bR)-4-(5-Bromo-1H-indol-3-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-8-yl]-2-propyn-1-ol
|
| Molecular Formula |
C22H19BrN2O2
|
| Molecular Weight |
423.3
|
| Smiles |
OCC#Cc1ccc2c(c1)C1OCCC1C(c1c[nH]c3ccc(Br)cc13)N2
|
OCC#Cc1ccc2c(c1)C1OCCC1C(c1c[nH]c3ccc(Br)cc13)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.