| Name | N-(5-allyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)-5-bromofuran-2-carboxamide | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C19H19BrN2O4 | 
                        
                        
                            | Molecular Weight | 419.3 | 
                        
                        
                            | Smiles | C=CCN1C(=O)C(C)(C)COc2cc(NC(=O)c3ccc(Br)o3)ccc21 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        C=CCN1C(=O)C(C)(C)COc2cc(NC(=O)c3ccc(Br)o3)ccc21
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.