| Name |
N-(4-methoxyphenyl)-2-{[5-methyl-3-(3-methylbutyl)-4-oxo-7-phenyl-3H,4H,5H-pyrrolo[3,2-d]pyrimidin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C27H30N4O3S
|
| Molecular Weight |
490.6
|
| Smiles |
COc1ccc(NC(=O)CSc2nc3c(-c4ccccc4)cn(C)c3c(=O)n2CCC(C)C)cc1
|
COc1ccc(NC(=O)CSc2nc3c(-c4ccccc4)cn(C)c3c(=O)n2CCC(C)C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.