| Name |
4-{1H-Pyrazolo[3,4-D]pyrimidin-4-YL}thiomorpholine
|
| Molecular Formula |
C9H11N5S
|
| Molecular Weight |
221.28
|
| Smiles |
c1nc(N2CCSCC2)c2cn[nH]c2n1
|
c1nc(N2CCSCC2)c2cn[nH]c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.