| Name |
5-ethyl-2,6-dimethyl-1H,4H-thieno[2,3-d]pyrimidin-4-one
|
| Molecular Formula |
C10H12N2OS
|
| Molecular Weight |
208.28
|
| Smiles |
CCc1c(C)sc2nc(C)[nH]c(=O)c12
|
CCc1c(C)sc2nc(C)[nH]c(=O)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.