| Name |
Ethyl 4-(2-chlorophenyl)-6-{[4-(3-methoxyphenyl)piperazin-1-yl]methyl}-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
|
| Molecular Formula |
C25H29ClN4O4
|
| Molecular Weight |
485.0
|
| Smiles |
CCOC(=O)C1=C(CN2CCN(c3cccc(OC)c3)CC2)NC(=O)NC1c1ccccc1Cl
|
CCOC(=O)C1=C(CN2CCN(c3cccc(OC)c3)CC2)NC(=O)NC1c1ccccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.