| Name |
1-[(1-cyano-1,2-dimethylpropyl)carbamoyl]ethyl 13-oxo-6H,7H,8H,9H,10H,11H,13H-azocino[2,1-b]quinazoline-3-carboxylate
|
| Molecular Formula |
C24H30N4O4
|
| Molecular Weight |
438.5
|
| Smiles |
CC(OC(=O)c1ccc2c(=O)n3c(nc2c1)CCCCCC3)C(=O)NC(C)(C#N)C(C)C
|
CC(OC(=O)c1ccc2c(=O)n3c(nc2c1)CCCCCC3)C(=O)NC(C)(C#N)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.