| Name |
[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl 2,5-dimethylfuran-3-carboxylate
|
| Molecular Formula |
C17H14FNO4
|
| Molecular Weight |
315.29
|
| Smiles |
Cc1cc(C(=O)OCc2cc(-c3ccc(F)cc3)on2)c(C)o1
|
Cc1cc(C(=O)OCc2cc(-c3ccc(F)cc3)on2)c(C)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.