| Name |
N-tert-butyl-2-{[3-(2,4-dimethylphenyl)-4-oxo-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C20H23N3O2S2
|
| Molecular Weight |
401.5
|
| Smiles |
Cc1ccc(-n2c(SCC(=O)NC(C)(C)C)nc3ccsc3c2=O)c(C)c1
|
Cc1ccc(-n2c(SCC(=O)NC(C)(C)C)nc3ccsc3c2=O)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.