| Name |
1-(1H-1,2,3-Benzotriazol-1-ylmethyl)pyridin-1-ium tetrafluoroboranuide
|
| Molecular Formula |
C12H11BF4N4
|
| Molecular Weight |
298.05
|
| Smiles |
F[B-](F)(F)F.c1cc[n+](Cn2nnc3ccccc32)cc1
|
F[B-](F)(F)F.c1cc[n+](Cn2nnc3ccccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.