| Name |
N-{5-[3-(dimethylamino)propyl]-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl}-2-propanesulfonamide
|
| Molecular Formula |
C11H25N5O2S
|
| Molecular Weight |
291.42
|
| Smiles |
CC(C)S(=O)(=O)NC1=NCN(CCCN(C)C)CN1
|
CC(C)S(=O)(=O)NC1=NCN(CCCN(C)C)CN1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.