| Name |
3-(6-oxo-3-phenylpyrazolo[5,1-c]pyrido[4,3-e][1,2,4]triazin-7(6H)-yl)propanoic acid
|
| Molecular Formula |
C17H13N5O3
|
| Molecular Weight |
335.32
|
| Smiles |
O=C(O)CCn1ccc2c(nnc3c(-c4ccccc4)cnn32)c1=O
|
O=C(O)CCn1ccc2c(nnc3c(-c4ccccc4)cnn32)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.