| Name |
N-(8,10-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepin-2-yl)-4-(N,N-dimethylsulfamoyl)benzamide
|
| Molecular Formula |
C24H23N3O5S
|
| Molecular Weight |
465.5
|
| Smiles |
Cc1ccc2c(c1)N(C)C(=O)c1cc(NC(=O)c3ccc(S(=O)(=O)N(C)C)cc3)ccc1O2
|
Cc1ccc2c(c1)N(C)C(=O)c1cc(NC(=O)c3ccc(S(=O)(=O)N(C)C)cc3)ccc1O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.