| Name |
3-(2-chlorophenyl)-5-methyl-N-(8-methyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepin-2-yl)isoxazole-4-carboxamide
|
| Molecular Formula |
C25H18ClN3O4
|
| Molecular Weight |
459.9
|
| Smiles |
Cc1ccc2c(c1)NC(=O)c1cc(NC(=O)c3c(-c4ccccc4Cl)noc3C)ccc1O2
|
Cc1ccc2c(c1)NC(=O)c1cc(NC(=O)c3c(-c4ccccc4Cl)noc3C)ccc1O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.