| Name |
Tert-butyl 7-(but-2-ynoylamino)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate
|
| Molecular Formula |
C16H22N4O3
|
| Molecular Weight |
318.37
|
| Smiles |
CC#CC(=O)NC1CN(C(=O)OC(C)(C)C)Cc2ccnn2C1
|
CC#CC(=O)NC1CN(C(=O)OC(C)(C)C)Cc2ccnn2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.