| Name |
3'-Bromo-5'-chloro-4'-(trifluoromethyl)phenacyl bromide
|
| Molecular Formula |
C9H4Br2ClF3O
|
| Molecular Weight |
380.38
|
| Smiles |
O=C(CBr)c1cc(Cl)c(C(F)(F)F)c(Br)c1
|
O=C(CBr)c1cc(Cl)c(C(F)(F)F)c(Br)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.