| Name |
2-(Oxan-4-yl)-2-oxoethyl 4-(prop-2-enamido)benzoate
|
| Molecular Formula |
C17H19NO5
|
| Molecular Weight |
317.34
|
| Smiles |
C=CC(=O)Nc1ccc(C(=O)OCC(=O)C2CCOCC2)cc1
|
C=CC(=O)Nc1ccc(C(=O)OCC(=O)C2CCOCC2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.