| Name |
2-Methyl-5-{thieno[2,3-d]pyrimidin-4-yl}-octahydropyrrolo[3,4-c]pyrrole-1,3-dione
|
| Molecular Formula |
C13H12N4O2S
|
| Molecular Weight |
288.33
|
| Smiles |
CN1C(=O)C2CN(c3ncnc4sccc34)CC2C1=O
|
CN1C(=O)C2CN(c3ncnc4sccc34)CC2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.