| Name |
2-(1-Piperidinylmethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine dihydrochloride
|
| Molecular Formula |
C12H22Cl2N4
|
| Molecular Weight |
293.23
|
| Smiles |
Cl.Cl.c1c(CN2CCCCC2)nn2c1CNCC2
|
Cl.Cl.c1c(CN2CCCCC2)nn2c1CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.