| Name |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-1,2,4-triazole
|
| Molecular Formula |
C14H18BN3O2
|
| Molecular Weight |
271.12
|
| Smiles |
CC1(C)OB(c2cccc(-n3cncn3)c2)OC1(C)C
|
CC1(C)OB(c2cccc(-n3cncn3)c2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.