| Name |
ethyl (3S)-3-amino-4,4,4-trifluoro-2,2-dimethylbutanoate
|
| Molecular Formula |
C8H14F3NO2
|
| Molecular Weight |
213.20
|
| Smiles |
CCOC(=O)C(C)(C)C(N)C(F)(F)F
|
CCOC(=O)C(C)(C)C(N)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.