| Name |
Di-tert-butyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,6-diyl)dicarbamate
|
| Molecular Formula |
C21H34BN3O6
|
| Molecular Weight |
435.3
|
| Smiles |
CC(C)(C)OC(=O)Nc1cc(B2OC(C)(C)C(C)(C)O2)cc(NC(=O)OC(C)(C)C)n1
|
CC(C)(C)OC(=O)Nc1cc(B2OC(C)(C)C(C)(C)O2)cc(NC(=O)OC(C)(C)C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.