| Name |
1-(3-Bromo-2,2-dimethylpropyl)-3,5-dimethoxybenzene
|
| Molecular Formula |
C13H19BrO2
|
| Molecular Weight |
287.19
|
| Smiles |
COc1cc(CC(C)(C)CBr)cc(OC)c1
|
COc1cc(CC(C)(C)CBr)cc(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.