| Name |
Furan-2-yl(4-((6-hydroxythiazolo[3,2-b][1,2,4]triazol-5-yl)(3,4,5-trimethoxyphenyl)methyl)piperazin-1-yl)methanone
|
| Molecular Formula |
C23H25N5O6S
|
| Molecular Weight |
499.5
|
| Smiles |
COc1cc(C(c2sc3ncnn3c2O)N2CCN(C(=O)c3ccco3)CC2)cc(OC)c1OC
|
COc1cc(C(c2sc3ncnn3c2O)N2CCN(C(=O)c3ccco3)CC2)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.