| Name |
ethyl 2-(9-(2-methoxyphenyl)-1-methyl-2,4-dioxo-1,2,6,7,8,9-hexahydropyrimido[2,1-f]purin-3(4H)-yl)acetate
|
| Molecular Formula |
C20H23N5O5
|
| Molecular Weight |
413.4
|
| Smiles |
CCOC(=O)Cn1c(=O)c2c(nc3n2CCCN3c2ccccc2OC)n(C)c1=O
|
CCOC(=O)Cn1c(=O)c2c(nc3n2CCCN3c2ccccc2OC)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.