| Name |
N-(9-((4AR,6R,7R,7aS)-2,2-di-tert-butyl-7-hydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl)-9H-purin-6-yl)benzamide
|
| Molecular Formula |
C25H33N5O5Si
|
| Molecular Weight |
511.6
|
| Smiles |
CC(C)(C)[Si]1(C(C)(C)C)OCC2OC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C(O)C2O1
|
CC(C)(C)[Si]1(C(C)(C)C)OCC2OC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C(O)C2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.