| Name |
3-(4-chlorophenyl)-7,9-dimethyl-1-(4-methylbenzyl)-7,9-dihydro-[1,2,4]triazino[3,4-f]purine-6,8(1H,4H)-dione
|
| Molecular Formula |
C23H21ClN6O2
|
| Molecular Weight |
448.9
|
| Smiles |
Cc1ccc(CN2N=C(c3ccc(Cl)cc3)Cn3c2nc2c3c(=O)n(C)c(=O)n2C)cc1
|
Cc1ccc(CN2N=C(c3ccc(Cl)cc3)Cn3c2nc2c3c(=O)n(C)c(=O)n2C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.