| Name |
4-(4-Ethyl-2,6-diiodophenoxy)-2,6-diiodophenol
|
| Molecular Formula |
C14H10I4O2
|
| Molecular Weight |
717.84
|
| Smiles |
CCc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1
|
CCc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.