| Name |
6-(((5-acetamido-1,3,4-thiadiazol-2-yl)thio)methyl)-4-oxo-4H-pyran-3-yl 2,5-dichlorobenzoate
|
| Molecular Formula |
C17H11Cl2N3O5S2
|
| Molecular Weight |
472.3
|
| Smiles |
CC(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)c3cc(Cl)ccc3Cl)co2)s1
|
CC(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)c3cc(Cl)ccc3Cl)co2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.