| Name |
N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-methoxybenzamide
|
| Molecular Formula |
C18H17N3O5
|
| Molecular Weight |
355.3
|
| Smiles |
COc1ccc(-c2nonc2NC(=O)c2ccccc2OC)cc1OC
|
COc1ccc(-c2nonc2NC(=O)c2ccccc2OC)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.