| Name |
3-(1,3-benzodioxol-5-yl)tetrahydrothieno[3,4-d][1,3]thiazol-2(3H)-imine 5,5-dioxide
|
| Molecular Formula |
C12H12N2O4S2
|
| Molecular Weight |
312.4
|
| Smiles |
N=C1SC2CS(=O)(=O)CC2N1c1ccc2c(c1)OCO2
|
N=C1SC2CS(=O)(=O)CC2N1c1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.