| Name |
4-methyl-2-oxo-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-7-carboxylic acid
|
| Molecular Formula |
C11H12N2O3
|
| Molecular Weight |
220.22
|
| Smiles |
CC1CC(=O)Nc2ccc(C(=O)O)cc2N1
|
CC1CC(=O)Nc2ccc(C(=O)O)cc2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.