| Name |
4H-[1,3,4]Thiadiazolo[2,3-c][1,2,4]triazin-4-one, 7-amino-3-[(4-ethoxyphenyl)methyl]-
|
| Molecular Formula |
C13H13N5O2S
|
| Molecular Weight |
303.34
|
| Smiles |
CCOc1ccc(Cc2nnc3sc(N)nn3c2=O)cc1
|
CCOc1ccc(Cc2nnc3sc(N)nn3c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.