| Name |
5-(4-Ethoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-amine
|
| Molecular Formula |
C13H13N5O
|
| Molecular Weight |
255.28
|
| Smiles |
CCOc1ccc(-c2nccc3nc(N)nn23)cc1
|
CCOc1ccc(-c2nccc3nc(N)nn23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.