| Name |
2,2,4-Trimethyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic acid
|
| Molecular Formula |
C12H13NO4
|
| Molecular Weight |
235.24
|
| Smiles |
CN1C(=O)C(C)(C)Oc2ccc(C(=O)O)cc21
|
CN1C(=O)C(C)(C)Oc2ccc(C(=O)O)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.