| Name |
1-(4,6-Dichloro-[1,3,5]-triazin-2-yl-amino)-imidazolidine-2,4-dione
|
| Molecular Formula |
C6H4Cl2N6O2
|
| Molecular Weight |
263.04
|
| Smiles |
O=C1CN(Nc2nc(Cl)nc(Cl)n2)C(=O)N1
|
O=C1CN(Nc2nc(Cl)nc(Cl)n2)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.