| Name |
3-Bromo-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyridine
|
| Molecular Formula |
C8H4BrF6NO
|
| Molecular Weight |
324.02
|
| Smiles |
FC(F)(F)C(Oc1ncccc1Br)C(F)(F)F
|
FC(F)(F)C(Oc1ncccc1Br)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.