| Name |
[1-(4-chloro-2,5-dimethoxyphenyl)-1H-1,2,3-triazol-4-yl]methanol
|
| Molecular Formula |
C11H12ClN3O3
|
| Molecular Weight |
269.68
|
| Smiles |
COc1cc(-n2cc(CO)nn2)c(OC)cc1Cl
|
COc1cc(-n2cc(CO)nn2)c(OC)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.