| Name |
2,2',2''-(2-(5-Iodothiophen-2-yl)ethene-1,1,2-triyl)trithiophene
|
| Molecular Formula |
C18H11IS4
|
| Molecular Weight |
482.5
|
| Smiles |
Ic1ccc(C(=C(c2cccs2)c2cccs2)c2cccs2)s1
|
Ic1ccc(C(=C(c2cccs2)c2cccs2)c2cccs2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.