| Name |
4,4''-Dibromo-[1,1':4',1''-terphenyl]-2',3'-diamine
|
| Molecular Formula |
C18H14Br2N2
|
| Molecular Weight |
418.1
|
| Smiles |
Nc1c(-c2ccc(Br)cc2)ccc(-c2ccc(Br)cc2)c1N
|
Nc1c(-c2ccc(Br)cc2)ccc(-c2ccc(Br)cc2)c1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.